C21H24BrClN2O2S — CID 40873560
(2R,7R)-2-(3-bromo-5-chloro-2-hydroxyphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 40873560) has the molecular formula C21H24BrClN2O2S and a molecular weight of 483.86 g/mol. Its IUPAC name is (2R,7R)-2-(3-bromo-5-chloro-2-hydroxyphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2R,7R)-2-(3-bromo-5-chloro-2-hydroxyphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 40873560 |
| Molecular Formula | C21H24BrClN2O2S |
| Molecular Weight | 483.86 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | (2R,7R)-2-(3-bromo-5-chloro-2-hydroxyphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCC(C)(C)[C@@H]1CCc2c(sc3c2C(=O)N[C@@H](c2cc(Cl)cc(Br)c2O)N3)C1 |
| InChI | InChI=1S/C21H24BrClN2O2S/c1-4-21(2,3)10-5-6-12-15(7-10)28-20-16(12)19(27)24-18(25-20)13-8-11(23)9-14(22)17(13)26/h8-10,18,25-26H,4-7H2,1-3H3,(H,24,27)/t10-,18-/m1/s1 |
| InChIKey | IVWULXATDPVHCT-MLCYQJTMSA-N |
| XLogP | 6.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.86 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|