C22H26Br2N2O2S — CID 98280296
(2R,7S)-2-(3,5-dibromo-4-methoxyphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 98280296) has the molecular formula C22H26Br2N2O2S and a molecular weight of 542.34 g/mol. Its IUPAC name is (2R,7S)-2-(3,5-dibromo-4-methoxyphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2R,7S)-2-(3,5-dibromo-4-methoxyphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 98280296 |
| Molecular Formula | C22H26Br2N2O2S |
| Molecular Weight | 542.34 g/mol |
| Exact Mass | 540.01 |
| IUPAC Name | (2R,7S)-2-(3,5-dibromo-4-methoxyphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCC(C)(C)[C@H]1CCc2c(sc3c2C(=O)N[C@@H](c2cc(Br)c(OC)c(Br)c2)N3)C1 |
| InChI | InChI=1S/C22H26Br2N2O2S/c1-5-22(2,3)12-6-7-13-16(10-12)29-21-17(13)20(27)25-19(26-21)11-8-14(23)18(28-4)15(24)9-11/h8-9,12,19,26H,5-7,10H2,1-4H3,(H,25,27)/t12-,19+/m0/s1 |
| InChIKey | NFRSTGHPMPGPNU-HXPMCKFVSA-N |
| XLogP | 6.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.34 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |