C21H25FN2OS — CID 7279774
(2S,7S)-2-(4-fluorophenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 7279774) has the molecular formula C21H25FN2OS and a molecular weight of 372.51 g/mol. Its IUPAC name is (2S,7S)-2-(4-fluorophenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2S,7S)-2-(4-fluorophenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7279774 |
| Molecular Formula | C21H25FN2OS |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (2S,7S)-2-(4-fluorophenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCC(C)(C)[C@H]1CCc2c(sc3c2C(=O)N[C@H](c2ccc(F)cc2)N3)C1 |
| InChI | InChI=1S/C21H25FN2OS/c1-4-21(2,3)13-7-10-15-16(11-13)26-20-17(15)19(25)23-18(24-20)12-5-8-14(22)9-6-12/h5-6,8-9,13,18,24H,4,7,10-11H2,1-3H3,(H,23,25)/t13-,18-/m0/s1 |
| InChIKey | YGYFJTRIWUSPDH-UGSOOPFHSA-N |
| XLogP | 5.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |