C24H32N2OS — CID 7281096
(2S,7S)-7-(2-methylbutan-2-yl)-2-(4-propan-2-ylphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 7281096) has the molecular formula C24H32N2OS and a molecular weight of 396.60 g/mol. Its IUPAC name is (2S,7S)-7-(2-methylbutan-2-yl)-2-(4-propan-2-ylphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2S,7S)-7-(2-methylbutan-2-yl)-2-(4-propan-2-ylphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7281096 |
| Molecular Formula | C24H32N2OS |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (2S,7S)-7-(2-methylbutan-2-yl)-2-(4-propan-2-ylphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCC(C)(C)[C@H]1CCc2c(sc3c2C(=O)N[C@H](c2ccc(C(C)C)cc2)N3)C1 |
| InChI | InChI=1S/C24H32N2OS/c1-6-24(4,5)17-11-12-18-19(13-17)28-23-20(18)22(27)25-21(26-23)16-9-7-15(8-10-16)14(2)3/h7-10,14,17,21,26H,6,11-13H2,1-5H3,(H,25,27)/t17-,21-/m0/s1 |
| InChIKey | HFAOYHOQFKTMMS-UWJYYQICSA-N |
| XLogP | 6.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |