C22H27IN2O2S — CID 3625030
2-(2-hydroxy-5-iodo-3-methylphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3625030) has the molecular formula C22H27IN2O2S and a molecular weight of 510.44 g/mol. Its IUPAC name is 2-(2-hydroxy-5-iodo-3-methylphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(2-hydroxy-5-iodo-3-methylphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3625030 |
| Molecular Formula | C22H27IN2O2S |
| Molecular Weight | 510.44 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 2-(2-hydroxy-5-iodo-3-methylphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCC(C)(C)C1CCc2c(sc3c2C(=O)NC(c2cc(I)cc(C)c2O)N3)C1 |
| InChI | InChI=1S/C22H27IN2O2S/c1-5-22(3,4)12-6-7-14-16(9-12)28-21-17(14)20(27)24-19(25-21)15-10-13(23)8-11(2)18(15)26/h8,10,12,19,25-26H,5-7,9H2,1-4H3,(H,24,27) |
| InChIKey | NPMHNUBOKNYWFN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.44 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|