C23H29IN2O3S — CID 98280076
(2S,7R)-2-(3-ethoxy-4-hydroxy-5-iodophenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 98280076) has the molecular formula C23H29IN2O3S and a molecular weight of 540.47 g/mol. Its IUPAC name is (2S,7R)-2-(3-ethoxy-4-hydroxy-5-iodophenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2S,7R)-2-(3-ethoxy-4-hydroxy-5-iodophenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 98280076 |
| Molecular Formula | C23H29IN2O3S |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | (2S,7R)-2-(3-ethoxy-4-hydroxy-5-iodophenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCOc1cc([C@H]2NC(=O)c3c(sc4c3CC[C@@H](C(C)(C)CC)C4)N2)cc(I)c1O |
| InChI | InChI=1S/C23H29IN2O3S/c1-5-23(3,4)13-7-8-14-17(11-13)30-22-18(14)21(28)25-20(26-22)12-9-15(24)19(27)16(10-12)29-6-2/h9-10,13,20,26-27H,5-8,11H2,1-4H3,(H,25,28)/t13-,20+/m1/s1 |
| InChIKey | LQHSZEPHOATKTF-XCLFUZPHSA-N |
| XLogP | 5.85 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|