C22H26Br2N2O3S — CID 98330789
(2S,7R)-7-tert-butyl-2-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 98330789) has the molecular formula C22H26Br2N2O3S and a molecular weight of 558.34 g/mol. Its IUPAC name is (2S,7R)-7-tert-butyl-2-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2S,7R)-7-tert-butyl-2-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 98330789 |
| Molecular Formula | C22H26Br2N2O3S |
| Molecular Weight | 558.34 g/mol |
| Exact Mass | 556.00 |
| IUPAC Name | (2S,7R)-7-tert-butyl-2-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCOc1cc([C@H]2NC(=O)c3c(sc4c3CC[C@@H](C(C)(C)C)C4)N2)c(Br)c(Br)c1O |
| InChI | InChI=1S/C22H26Br2N2O3S/c1-5-29-13-9-12(16(23)17(24)18(13)27)19-25-20(28)15-11-7-6-10(22(2,3)4)8-14(11)30-21(15)26-19/h9-10,19,26-27H,5-8H2,1-4H3,(H,25,28)/t10-,19+/m1/s1 |
| InChIKey | QZZFVYZGISEXOH-DGIBIBHMSA-N |
| XLogP | 6.38 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.34 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |