C22H27N3O5S — CID 40853218
(2S,7R)-7-tert-butyl-2-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 40853218) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is (2S,7R)-7-tert-butyl-2-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2S,7R)-7-tert-butyl-2-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 40853218 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (2S,7R)-7-tert-butyl-2-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCOc1cc([C@H]2NC(=O)c3c(sc4c3CC[C@@H](C(C)(C)C)C4)N2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C22H27N3O5S/c1-5-30-15-9-11(8-14(18(15)26)25(28)29)19-23-20(27)17-13-7-6-12(22(2,3)4)10-16(13)31-21(17)24-19/h8-9,12,19,24,26H,5-7,10H2,1-4H3,(H,23,27)/t12-,19+/m1/s1 |
| InChIKey | OCNKLNATCZKFGP-BLVKFPJESA-N |
| XLogP | 4.77 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|