C29H32N4O7S — CID 3738763
2-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3738763) has the molecular formula C29H32N4O7S and a molecular weight of 580.66 g/mol. Its IUPAC name is 2-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3738763 |
| Molecular Formula | C29H32N4O7S |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 2-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCOc1cc(C2NC(=O)c3c(sc4c3CCC(C(C)(C)CC)C4)N2)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H32N4O7S/c1-5-29(3,4)17-8-10-19-24(14-17)41-28-25(19)27(34)30-26(31-28)16-7-11-22(23(13-16)39-6-2)40-21-12-9-18(32(35)36)15-20(21)33(37)38/h7,9,11-13,15,17,26,31H,5-6,8,10,14H2,1-4H3,(H,30,34) |
| InChIKey | GGTNJFFKTJXNLZ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|