C18H19IN2O3S — CID 3813458
2-(4-hydroxy-3-iodo-5-methoxyphenyl)-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3813458) has the molecular formula C18H19IN2O3S and a molecular weight of 470.33 g/mol. Its IUPAC name is 2-(4-hydroxy-3-iodo-5-methoxyphenyl)-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-hydroxy-3-iodo-5-methoxyphenyl)-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3813458 |
| Molecular Formula | C18H19IN2O3S |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | 2-(4-hydroxy-3-iodo-5-methoxyphenyl)-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | COc1cc(C2NC(=O)c3c(sc4c3CCC(C)C4)N2)cc(I)c1O |
| InChI | InChI=1S/C18H19IN2O3S/c1-8-3-4-10-13(5-8)25-18-14(10)17(23)20-16(21-18)9-6-11(19)15(22)12(7-9)24-2/h6-8,16,21-22H,3-5H2,1-2H3,(H,20,23) |
| InChIKey | YIKLNFAMXRHQHE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|