C18H18I2N2O2S — CID 3472521
2-(3,5-diiodo-2-methoxyphenyl)-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3472521) has the molecular formula C18H18I2N2O2S and a molecular weight of 580.23 g/mol. Its IUPAC name is 2-(3,5-diiodo-2-methoxyphenyl)-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(3,5-diiodo-2-methoxyphenyl)-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3472521 |
| Molecular Formula | C18H18I2N2O2S |
| Molecular Weight | 580.23 g/mol |
| Exact Mass | 579.92 |
| IUPAC Name | 2-(3,5-diiodo-2-methoxyphenyl)-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | COc1c(I)cc(I)cc1C1NC(=O)c2c(sc3c2CCC(C)C3)N1 |
| InChI | InChI=1S/C18H18I2N2O2S/c1-8-3-4-10-13(5-8)25-18-14(10)17(23)21-16(22-18)11-6-9(19)7-12(20)15(11)24-2/h6-8,16,22H,3-5H2,1-2H3,(H,21,23) |
| InChIKey | IKDMXHJNFYBXLQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.23 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|