C21H24I2N2O2S — CID 98160383
(2R,7S)-7-tert-butyl-2-(3,5-diiodo-2-methoxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 98160383) has the molecular formula C21H24I2N2O2S and a molecular weight of 622.31 g/mol. Its IUPAC name is (2R,7S)-7-tert-butyl-2-(3,5-diiodo-2-methoxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2R,7S)-7-tert-butyl-2-(3,5-diiodo-2-methoxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 98160383 |
| Molecular Formula | C21H24I2N2O2S |
| Molecular Weight | 622.31 g/mol |
| Exact Mass | 621.96 |
| IUPAC Name | (2R,7S)-7-tert-butyl-2-(3,5-diiodo-2-methoxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | COc1c(I)cc(I)cc1[C@@H]1NC(=O)c2c(sc3c2CC[C@H](C(C)(C)C)C3)N1 |
| InChI | InChI=1S/C21H24I2N2O2S/c1-21(2,3)10-5-6-12-15(7-10)28-20-16(12)19(26)24-18(25-20)13-8-11(22)9-14(23)17(13)27-4/h8-10,18,25H,5-7H2,1-4H3,(H,24,26)/t10-,18+/m0/s1 |
| InChIKey | NQKWZKQXWCJSCU-XTZNXHDOSA-N |
| XLogP | 5.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.31 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|