C20H23IN2O2S — CID 23792778
7-tert-butyl-2-(4-hydroxy-3-iodophenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 23792778) has the molecular formula C20H23IN2O2S and a molecular weight of 482.39 g/mol. Its IUPAC name is 7-tert-butyl-2-(4-hydroxy-3-iodophenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-tert-butyl-2-(4-hydroxy-3-iodophenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23792778 |
| Molecular Formula | C20H23IN2O2S |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 7-tert-butyl-2-(4-hydroxy-3-iodophenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CC(C)(C)C1CCc2c(sc3c2C(=O)NC(c2ccc(O)c(I)c2)N3)C1 |
| InChI | InChI=1S/C20H23IN2O2S/c1-20(2,3)11-5-6-12-15(9-11)26-19-16(12)18(25)22-17(23-19)10-4-7-14(24)13(21)8-10/h4,7-8,11,17,23-24H,5-6,9H2,1-3H3,(H,22,25) |
| InChIKey | YPWZNVGUQUGENQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|