C19H21BrN2O3S — CID 3725973
2-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-ethyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3725973) has the molecular formula C19H21BrN2O3S and a molecular weight of 437.36 g/mol. Its IUPAC name is 2-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-ethyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-ethyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3725973 |
| Molecular Formula | C19H21BrN2O3S |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-ethyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCC1CCc2c(sc3c2C(=O)NC(c2cc(Br)c(O)c(OC)c2)N3)C1 |
| InChI | InChI=1S/C19H21BrN2O3S/c1-3-9-4-5-11-14(6-9)26-19-15(11)18(24)21-17(22-19)10-7-12(20)16(23)13(8-10)25-2/h7-9,17,22-23H,3-6H2,1-2H3,(H,21,24) |
| InChIKey | PFOWIHQBYOLWEJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |