C18H18Br2N2O2S — CID 26874651
(2R,7S)-2-(3,5-dibromo-4-hydroxyphenyl)-7-ethyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 26874651) has the molecular formula C18H18Br2N2O2S and a molecular weight of 486.23 g/mol. Its IUPAC name is (2R,7S)-2-(3,5-dibromo-4-hydroxyphenyl)-7-ethyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2R,7S)-2-(3,5-dibromo-4-hydroxyphenyl)-7-ethyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 26874651 |
| Molecular Formula | C18H18Br2N2O2S |
| Molecular Weight | 486.23 g/mol |
| Exact Mass | 483.95 |
| IUPAC Name | (2R,7S)-2-(3,5-dibromo-4-hydroxyphenyl)-7-ethyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CC[C@H]1CCc2c(sc3c2C(=O)N[C@@H](c2cc(Br)c(O)c(Br)c2)N3)C1 |
| InChI | InChI=1S/C18H18Br2N2O2S/c1-2-8-3-4-10-13(5-8)25-18-14(10)17(24)21-16(22-18)9-6-11(19)15(23)12(20)7-9/h6-8,16,22-23H,2-5H2,1H3,(H,21,24)/t8-,16+/m0/s1 |
| InChIKey | NQZWQEZWWZMJIX-ZKANADHPSA-N |
| XLogP | 5.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.23 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |