C16H15Br2N3O2S — CID 3816879
5-(3,5-dibromo-4-hydroxyphenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one (PubChem CID 3816879) has the molecular formula C16H15Br2N3O2S and a molecular weight of 473.19 g/mol. Its IUPAC name is 5-(3,5-dibromo-4-hydroxyphenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one.
| Compound Name | 5-(3,5-dibromo-4-hydroxyphenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
|---|---|
| PubChem CID | 3816879 |
| Molecular Formula | C16H15Br2N3O2S |
| Molecular Weight | 473.19 g/mol |
| Exact Mass | 470.93 |
| IUPAC Name | 5-(3,5-dibromo-4-hydroxyphenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
| SMILES | CN1CCc2c(sc3c2C(=O)NC(c2cc(Br)c(O)c(Br)c2)N3)C1 |
| InChI | InChI=1S/C16H15Br2N3O2S/c1-21-3-2-8-11(6-21)24-16-12(8)15(23)19-14(20-16)7-4-9(17)13(22)10(18)5-7/h4-5,14,20,22H,2-3,6H2,1H3,(H,19,23) |
| InChIKey | HCVLXVPYHUZBNV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.19 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |