C19H20Br2N2O2S — CID 3801405
2-(3,5-dibromo-2-methoxyphenyl)-7-ethyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3801405) has the molecular formula C19H20Br2N2O2S and a molecular weight of 500.26 g/mol. Its IUPAC name is 2-(3,5-dibromo-2-methoxyphenyl)-7-ethyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(3,5-dibromo-2-methoxyphenyl)-7-ethyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3801405 |
| Molecular Formula | C19H20Br2N2O2S |
| Molecular Weight | 500.26 g/mol |
| Exact Mass | 497.96 |
| IUPAC Name | 2-(3,5-dibromo-2-methoxyphenyl)-7-ethyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCC1CCc2c(sc3c2C(=O)NC(c2cc(Br)cc(Br)c2OC)N3)C1 |
| InChI | InChI=1S/C19H20Br2N2O2S/c1-3-9-4-5-11-14(6-9)26-19-15(11)18(24)22-17(23-19)12-7-10(20)8-13(21)16(12)25-2/h7-9,17,23H,3-6H2,1-2H3,(H,22,24) |
| InChIKey | SBRPKEOWLOGEME-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.26 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |