C19H21Br2N3O2S — CID 3695213
5-(3,5-dibromo-2-methoxyphenyl)-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one (PubChem CID 3695213) has the molecular formula C19H21Br2N3O2S and a molecular weight of 515.27 g/mol. Its IUPAC name is 5-(3,5-dibromo-2-methoxyphenyl)-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one.
| Compound Name | 5-(3,5-dibromo-2-methoxyphenyl)-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
|---|---|
| PubChem CID | 3695213 |
| Molecular Formula | C19H21Br2N3O2S |
| Molecular Weight | 515.27 g/mol |
| Exact Mass | 512.97 |
| IUPAC Name | 5-(3,5-dibromo-2-methoxyphenyl)-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
| SMILES | COc1c(Br)cc(Br)cc1C1NC(=O)c2c(sc3c2CCN(C(C)C)C3)N1 |
| InChI | InChI=1S/C19H21Br2N3O2S/c1-9(2)24-5-4-11-14(8-24)27-19-15(11)18(25)22-17(23-19)12-6-10(20)7-13(21)16(12)26-3/h6-7,9,17,23H,4-5,8H2,1-3H3,(H,22,25) |
| InChIKey | NERGRJNUWKEOSJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.27 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |