C16H14BrClN2O2S — CID 35212808
(2R)-2-(3-bromo-5-chloro-2-hydroxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 35212808) has the molecular formula C16H14BrClN2O2S and a molecular weight of 413.72 g/mol. Its IUPAC name is (2R)-2-(3-bromo-5-chloro-2-hydroxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2R)-2-(3-bromo-5-chloro-2-hydroxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 35212808 |
| Molecular Formula | C16H14BrClN2O2S |
| Molecular Weight | 413.72 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | (2R)-2-(3-bromo-5-chloro-2-hydroxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=C1N[C@@H](c2cc(Cl)cc(Br)c2O)Nc2sc3c(c21)CCCC3 |
| InChI | InChI=1S/C16H14BrClN2O2S/c17-10-6-7(18)5-9(13(10)21)14-19-15(22)12-8-3-1-2-4-11(8)23-16(12)20-14/h5-6,14,20-21H,1-4H2,(H,19,22)/t14-/m1/s1 |
| InChIKey | VMUVYMRRGVZRGP-CQSZACIVSA-N |
| XLogP | 4.60 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.72 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|