C17H16Br2N2O3S — CID 4770769
2-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 4770769) has the molecular formula C17H16Br2N2O3S and a molecular weight of 488.20 g/mol. Its IUPAC name is 2-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4770769 |
| Molecular Formula | C17H16Br2N2O3S |
| Molecular Weight | 488.20 g/mol |
| Exact Mass | 485.92 |
| IUPAC Name | 2-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | COc1cc(Br)c(Br)c(C2NC(=O)c3c(sc4c3CCCC4)N2)c1O |
| InChI | InChI=1S/C17H16Br2N2O3S/c1-24-9-6-8(18)13(19)12(14(9)22)15-20-16(23)11-7-4-2-3-5-10(7)25-17(11)21-15/h6,15,21-22H,2-5H2,1H3,(H,20,23) |
| InChIKey | ZGADXOJGHNOIDH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.20 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|