C16H15N3O4S — CID 958027
(2R)-2-(5-hydroxy-2-nitrophenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 958027) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is (2R)-2-(5-hydroxy-2-nitrophenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2R)-2-(5-hydroxy-2-nitrophenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 958027 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | (2R)-2-(5-hydroxy-2-nitrophenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=C1N[C@@H](c2cc(O)ccc2[N+](=O)[O-])Nc2sc3c(c21)CCCC3 |
| InChI | InChI=1S/C16H15N3O4S/c20-8-5-6-11(19(22)23)10(7-8)14-17-15(21)13-9-3-1-2-4-12(9)24-16(13)18-14/h5-7,14,18,20H,1-4H2,(H,17,21)/t14-/m1/s1 |
| InChIKey | VOYJRFZQHBGNHT-CQSZACIVSA-N |
| XLogP | 3.09 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|