C25H23ClN2O4S — CID 26876174
[2-methoxy-4-[(2R,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 2-chlorobenzoate (PubChem CID 26876174) has the molecular formula C25H23ClN2O4S and a molecular weight of 482.99 g/mol. Its IUPAC name is [2-methoxy-4-[(2R,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 2-chlorobenzoate.
| Compound Name | [2-methoxy-4-[(2R,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 26876174 |
| Molecular Formula | C25H23ClN2O4S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | [2-methoxy-4-[(2R,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 2-chlorobenzoate |
| SMILES | COc1cc([C@@H]2NC(=O)c3c(sc4c3CC[C@H](C)C4)N2)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C25H23ClN2O4S/c1-13-7-9-16-20(11-13)33-24-21(16)23(29)27-22(28-24)14-8-10-18(19(12-14)31-2)32-25(30)15-5-3-4-6-17(15)26/h3-6,8,10,12-13,22,28H,7,9,11H2,1-2H3,(H,27,29)/t13-,22+/m0/s1 |
| InChIKey | MEZHPBVGMRHYNA-WHEQGISXSA-N |
| XLogP | 5.61 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|