C26H28N2O3S2 — CID 40873501
[3-[(2S,7S)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] thiophene-2-carboxylate (PubChem CID 40873501) has the molecular formula C26H28N2O3S2 and a molecular weight of 480.66 g/mol. Its IUPAC name is [3-[(2S,7S)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] thiophene-2-carboxylate.
| Compound Name | [3-[(2S,7S)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 40873501 |
| Molecular Formula | C26H28N2O3S2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | [3-[(2S,7S)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] thiophene-2-carboxylate |
| SMILES | CCC(C)(C)[C@H]1CCc2c(sc3c2C(=O)N[C@H](c2cccc(OC(=O)c4cccs4)c2)N3)C1 |
| InChI | InChI=1S/C26H28N2O3S2/c1-4-26(2,3)16-10-11-18-20(14-16)33-24-21(18)23(29)27-22(28-24)15-7-5-8-17(13-15)31-25(30)19-9-6-12-32-19/h5-9,12-13,16,22,28H,4,10-11,14H2,1-3H3,(H,27,29)/t16-,22-/m0/s1 |
| InChIKey | BDUJXAGOQYWNSO-AOMKIAJQSA-N |
| XLogP | 6.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|