C21H18N2O3S2 — CID 4770698
[3-(4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)phenyl] thiophene-2-carboxylate (PubChem CID 4770698) has the molecular formula C21H18N2O3S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is [3-(4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)phenyl] thiophene-2-carboxylate.
| Compound Name | [3-(4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 4770698 |
| Molecular Formula | C21H18N2O3S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | [3-(4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)phenyl] thiophene-2-carboxylate |
| SMILES | O=C(Oc1cccc(C2NC(=O)c3c(sc4c3CCCC4)N2)c1)c1cccs1 |
| InChI | InChI=1S/C21H18N2O3S2/c24-19-17-14-7-1-2-8-15(14)28-20(17)23-18(22-19)12-5-3-6-13(11-12)26-21(25)16-9-4-10-27-16/h3-6,9-11,18,23H,1-2,7-8H2,(H,22,24) |
| InChIKey | VWRXXXHAPGLJTR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|