C22H20N2O3S2 — CID 26876324
[3-[(2S,7R)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] thiophene-2-carboxylate (PubChem CID 26876324) has the molecular formula C22H20N2O3S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is [3-[(2S,7R)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] thiophene-2-carboxylate.
| Compound Name | [3-[(2S,7R)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 26876324 |
| Molecular Formula | C22H20N2O3S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | [3-[(2S,7R)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] thiophene-2-carboxylate |
| SMILES | C[C@@H]1CCc2c(sc3c2C(=O)N[C@H](c2cccc(OC(=O)c4cccs4)c2)N3)C1 |
| InChI | InChI=1S/C22H20N2O3S2/c1-12-7-8-15-17(10-12)29-21-18(15)20(25)23-19(24-21)13-4-2-5-14(11-13)27-22(26)16-6-3-9-28-16/h2-6,9,11-12,19,24H,7-8,10H2,1H3,(H,23,25)/t12-,19+/m1/s1 |
| InChIKey | VBNCUZIHZUJHJH-BLVKFPJESA-N |
| XLogP | 5.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|