C19H29NO — CID 142104202
1-[3-methyl-N-[(4-methylcyclohexyl)methyl]anilino]but-1-en-1-ol (PubChem CID 142104202) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-[3-methyl-N-[(4-methylcyclohexyl)methyl]anilino]but-1-en-1-ol.
| Compound Name | 1-[3-methyl-N-[(4-methylcyclohexyl)methyl]anilino]but-1-en-1-ol |
|---|---|
| PubChem CID | 142104202 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 1-[3-methyl-N-[(4-methylcyclohexyl)methyl]anilino]but-1-en-1-ol |
| SMILES | CCC=C(O)N(CC1CCC(C)CC1)c1cccc(C)c1 |
| InChI | InChI=1S/C19H29NO/c1-4-6-19(21)20(18-8-5-7-16(3)13-18)14-17-11-9-15(2)10-12-17/h5-8,13,15,17,21H,4,9-12,14H2,1-3H3 |
| InChIKey | KFKOGTGOGOJBTD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|