C21H22F3NOS — CID 142106432
4-[3-[4-(2-methylcyclopropyl)-2-(trifluoromethyl)phenyl]sulfanylphenyl]morpholine (PubChem CID 142106432) has the molecular formula C21H22F3NOS and a molecular weight of 393.47 g/mol. Its IUPAC name is 4-[3-[4-(2-methylcyclopropyl)-2-(trifluoromethyl)phenyl]sulfanylphenyl]morpholine.
| Compound Name | 4-[3-[4-(2-methylcyclopropyl)-2-(trifluoromethyl)phenyl]sulfanylphenyl]morpholine |
|---|---|
| PubChem CID | 142106432 |
| Molecular Formula | C21H22F3NOS |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 4-[3-[4-(2-methylcyclopropyl)-2-(trifluoromethyl)phenyl]sulfanylphenyl]morpholine |
| SMILES | CC1CC1c1ccc(Sc2cccc(N3CCOCC3)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F3NOS/c1-14-11-18(14)15-5-6-20(19(12-15)21(22,23)24)27-17-4-2-3-16(13-17)25-7-9-26-10-8-25/h2-6,12-14,18H,7-11H2,1H3 |
| InChIKey | OIGWAWUJOCEUDY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |