C23H26N2O4 — CID 142106724
(3-methoxy-4-nitrophenyl)-spiro[3,5-dihydro-2H-1-benzazepine-4,1'-cyclohexane]-1-ylmethanone (PubChem CID 142106724) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (3-methoxy-4-nitrophenyl)-spiro[3,5-dihydro-2H-1-benzazepine-4,1'-cyclohexane]-1-ylmethanone.
| Compound Name | (3-methoxy-4-nitrophenyl)-spiro[3,5-dihydro-2H-1-benzazepine-4,1'-cyclohexane]-1-ylmethanone |
|---|---|
| PubChem CID | 142106724 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (3-methoxy-4-nitrophenyl)-spiro[3,5-dihydro-2H-1-benzazepine-4,1'-cyclohexane]-1-ylmethanone |
| SMILES | COc1cc(C(=O)N2CCC3(CCCCC3)Cc3ccccc32)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H26N2O4/c1-29-21-15-17(9-10-20(21)25(27)28)22(26)24-14-13-23(11-5-2-6-12-23)16-18-7-3-4-8-19(18)24/h3-4,7-10,15H,2,5-6,11-14,16H2,1H3 |
| InChIKey | NFLJXSMMJBRZGJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|