C14H19NO3 — CID 142107049
(2S)-3-[4-[(E)-2-hydroxyprop-1-enyl]-5-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]-2-methylpropanoic acid (PubChem CID 142107049) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (2S)-3-[4-[(E)-2-hydroxyprop-1-enyl]-5-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[4-[(E)-2-hydroxyprop-1-enyl]-5-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 142107049 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (2S)-3-[4-[(E)-2-hydroxyprop-1-enyl]-5-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]-2-methylpropanoic acid |
| SMILES | C/C=C\c1[nH]cc(C[C@H](C)C(=O)O)c1/C=C(\C)O |
| InChI | InChI=1S/C14H19NO3/c1-4-5-13-12(7-10(3)16)11(8-15-13)6-9(2)14(17)18/h4-5,7-9,15-16H,6H2,1-3H3,(H,17,18)/b5-4-,10-7+/t9-/m0/s1 |
| InChIKey | ZINDKNMRKHIMTJ-BKUZFOJKSA-N |
| XLogP | 3.23 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|