C13H23N3O — CID 143620985
3-[5-amino-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]-2-methylpropanamide;ethane (PubChem CID 143620985) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-[5-amino-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]-2-methylpropanamide;ethane.
| Compound Name | 3-[5-amino-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]-2-methylpropanamide;ethane |
|---|---|
| PubChem CID | 143620985 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 3-[5-amino-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]-2-methylpropanamide;ethane |
| SMILES | C/C=C\c1c(CC(C)C(N)=O)c[nH]c1N.CC |
| InChI | InChI=1S/C11H17N3O.C2H6/c1-3-4-9-8(6-14-10(9)12)5-7(2)11(13)15;1-2/h3-4,6-7,14H,5,12H2,1-2H3,(H2,13,15);1-2H3/b4-3-; |
| InChIKey | JZCICSIFUYDIQO-LNKPDPKZSA-N |
| XLogP | 2.32 |
| TPSA | 84.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |