C17H21N3O2S — CID 142107240
(7R)-2-amino-7-(aminomethyl)-6-[(1R)-1-phenylethyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid (PubChem CID 142107240) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is (7R)-2-amino-7-(aminomethyl)-6-[(1R)-1-phenylethyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid.
| Compound Name | (7R)-2-amino-7-(aminomethyl)-6-[(1R)-1-phenylethyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 142107240 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (7R)-2-amino-7-(aminomethyl)-6-[(1R)-1-phenylethyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid |
| SMILES | C[C@H](c1ccccc1)N1CCc2c(sc(N)c2C(=O)O)[C@H]1CN |
| InChI | InChI=1S/C17H21N3O2S/c1-10(11-5-3-2-4-6-11)20-8-7-12-14(17(21)22)16(19)23-15(12)13(20)9-18/h2-6,10,13H,7-9,18-19H2,1H3,(H,21,22)/t10-,13-/m1/s1 |
| InChIKey | SOLABLLRLULQLI-ZWNOBZJWSA-N |
| XLogP | 2.65 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|