C25H37N3O5S — CID 142108447
N-benzyl-N-(2-methyl-3-nitrosopentyl)-2-nitrobenzenesulfonamide;cyclobutane;ethane (PubChem CID 142108447) has the molecular formula C25H37N3O5S and a molecular weight of 491.65 g/mol. Its IUPAC name is N-benzyl-N-(2-methyl-3-nitrosopentyl)-2-nitrobenzenesulfonamide;cyclobutane;ethane.
| Compound Name | N-benzyl-N-(2-methyl-3-nitrosopentyl)-2-nitrobenzenesulfonamide;cyclobutane;ethane |
|---|---|
| PubChem CID | 142108447 |
| Molecular Formula | C25H37N3O5S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | N-benzyl-N-(2-methyl-3-nitrosopentyl)-2-nitrobenzenesulfonamide;cyclobutane;ethane |
| SMILES | C1CCC1.CC.CCC(N=O)C(C)CN(Cc1ccccc1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H23N3O5S.C4H8.C2H6/c1-3-17(20-23)15(2)13-21(14-16-9-5-4-6-10-16)28(26,27)19-12-8-7-11-18(19)22(24)25;1-2-4-3-1;1-2/h4-12,15,17H,3,13-14H2,1-2H3;1-4H2;1-2H3 |
| InChIKey | PKSPUETZYGXNPK-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 109.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|