C35H52N2O3 — CID 142109749
3-[2-[[3-[2-cyclohexyl-2-(3-phenylprop-1-en-2-ylamino)acetyl]-6,6-dimethyl-2-bicyclo[3.1.0]hexanyl]methoxy]ethyl]-2-methylidenehexanamide (PubChem CID 142109749) has the molecular formula C35H52N2O3 and a molecular weight of 548.81 g/mol. Its IUPAC name is 3-[2-[[3-[2-cyclohexyl-2-(3-phenylprop-1-en-2-ylamino)acetyl]-6,6-dimethyl-2-bicyclo[3.1.0]hexanyl]methoxy]ethyl]-2-methylidenehexanamide.
| Compound Name | 3-[2-[[3-[2-cyclohexyl-2-(3-phenylprop-1-en-2-ylamino)acetyl]-6,6-dimethyl-2-bicyclo[3.1.0]hexanyl]methoxy]ethyl]-2-methylidenehexanamide |
|---|---|
| PubChem CID | 142109749 |
| Molecular Formula | C35H52N2O3 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.40 |
| IUPAC Name | 3-[2-[[3-[2-cyclohexyl-2-(3-phenylprop-1-en-2-ylamino)acetyl]-6,6-dimethyl-2-bicyclo[3.1.0]hexanyl]methoxy]ethyl]-2-methylidenehexanamide |
| SMILES | C=C(Cc1ccccc1)NC(C(=O)C1CC2C(C1COCCC(CCC)C(=C)C(N)=O)C2(C)C)C1CCCCC1 |
| InChI | InChI=1S/C35H52N2O3/c1-6-13-26(24(3)34(36)39)18-19-40-22-29-28(21-30-31(29)35(30,4)5)33(38)32(27-16-11-8-12-17-27)37-23(2)20-25-14-9-7-10-15-25/h7,9-10,14-15,26-32,37H,2-3,6,8,11-13,16-22H2,1,4-5H3,(H2,36,39) |
| InChIKey | AAFXWCZQZODMNW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|