C30H49N3O4 — CID 142109998
(3S)-N-(1-cyclobutyl-3,4-dioxobutan-2-yl)-1-[3-cyclohexyl-3-(3,4-dimethylpentanoylamino)prop-1-en-2-yl]-3-methylpyrrolidine-2-carboxamide (PubChem CID 142109998) has the molecular formula C30H49N3O4 and a molecular weight of 515.74 g/mol. Its IUPAC name is (3S)-N-(1-cyclobutyl-3,4-dioxobutan-2-yl)-1-[3-cyclohexyl-3-(3,4-dimethylpentanoylamino)prop-1-en-2-yl]-3-methylpyrrolidine-2-carboxamide.
| Compound Name | (3S)-N-(1-cyclobutyl-3,4-dioxobutan-2-yl)-1-[3-cyclohexyl-3-(3,4-dimethylpentanoylamino)prop-1-en-2-yl]-3-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 142109998 |
| Molecular Formula | C30H49N3O4 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.37 |
| IUPAC Name | (3S)-N-(1-cyclobutyl-3,4-dioxobutan-2-yl)-1-[3-cyclohexyl-3-(3,4-dimethylpentanoylamino)prop-1-en-2-yl]-3-methylpyrrolidine-2-carboxamide |
| SMILES | C=C(C(NC(=O)CC(C)C(C)C)C1CCCCC1)N1CC[C@H](C)C1C(=O)NC(CC1CCC1)C(=O)C=O |
| InChI | InChI=1S/C30H49N3O4/c1-19(2)21(4)16-27(36)32-28(24-12-7-6-8-13-24)22(5)33-15-14-20(3)29(33)30(37)31-25(26(35)18-34)17-23-10-9-11-23/h18-21,23-25,28-29H,5-17H2,1-4H3,(H,31,37)(H,32,36)/t20-,21?,25?,28?,29?/m0/s1 |
| InChIKey | ZWQVLWJWXMJMAM-NILFGGECSA-N |
| XLogP | 4.40 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|