C32H42N4OS2 — CID 142111200
(Z,5Z)-5-ethylidene-4,8-dimethyl-N-[(1-methylimidazol-2-yl)methyl]-N-[8-(thiophen-2-ylsulfanylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]non-6-enamide (PubChem CID 142111200) has the molecular formula C32H42N4OS2 and a molecular weight of 562.85 g/mol. Its IUPAC name is (Z,5Z)-5-ethylidene-4,8-dimethyl-N-[(1-methylimidazol-2-yl)methyl]-N-[8-(thiophen-2-ylsulfanylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]non-6-enamide.
| Compound Name | (Z,5Z)-5-ethylidene-4,8-dimethyl-N-[(1-methylimidazol-2-yl)methyl]-N-[8-(thiophen-2-ylsulfanylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]non-6-enamide |
|---|---|
| PubChem CID | 142111200 |
| Molecular Formula | C32H42N4OS2 |
| Molecular Weight | 562.85 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | (Z,5Z)-5-ethylidene-4,8-dimethyl-N-[(1-methylimidazol-2-yl)methyl]-N-[8-(thiophen-2-ylsulfanylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]non-6-enamide |
| SMILES | C/C=C(\C=C/C(C)C)C(C)CCC(=O)N(Cc1nccn1C)c1ccc2c(c1)C(NSc1cccs1)CCC2 |
| InChI | InChI=1S/C32H42N4OS2/c1-6-25(14-12-23(2)3)24(4)13-17-31(37)36(22-30-33-18-19-35(30)5)27-16-15-26-9-7-10-29(28(26)21-27)34-39-32-11-8-20-38-32/h6,8,11-12,14-16,18-21,23-24,29,34H,7,9-10,13,17,22H2,1-5H3/b14-12-,25-6+ |
| InChIKey | RUVZUMHSBFHHPV-MPTGDHSYSA-N |
| XLogP | 8.26 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.85 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|