C32H34F2N4O3S — CID 59063658
(3S)-3-(2,4-difluorophenyl)-N-[(1-methylimidazol-2-yl)methyl]-N-[(8R)-8-[(3-methylphenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]butanamide (PubChem CID 59063658) has the molecular formula C32H34F2N4O3S and a molecular weight of 592.71 g/mol. Its IUPAC name is (3S)-3-(2,4-difluorophenyl)-N-[(1-methylimidazol-2-yl)methyl]-N-[(8R)-8-[(3-methylphenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]butanamide.
| Compound Name | (3S)-3-(2,4-difluorophenyl)-N-[(1-methylimidazol-2-yl)methyl]-N-[(8R)-8-[(3-methylphenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]butanamide |
|---|---|
| PubChem CID | 59063658 |
| Molecular Formula | C32H34F2N4O3S |
| Molecular Weight | 592.71 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | (3S)-3-(2,4-difluorophenyl)-N-[(1-methylimidazol-2-yl)methyl]-N-[(8R)-8-[(3-methylphenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]butanamide |
| SMILES | Cc1cccc(S(=O)(=O)N[C@@H]2CCCc3ccc(N(Cc4nccn4C)C(=O)C[C@H](C)c4ccc(F)cc4F)cc32)c1 |
| InChI | InChI=1S/C32H34F2N4O3S/c1-21-6-4-8-26(16-21)42(40,41)36-30-9-5-7-23-10-12-25(19-28(23)30)38(20-31-35-14-15-37(31)3)32(39)17-22(2)27-13-11-24(33)18-29(27)34/h4,6,8,10-16,18-19,22,30,36H,5,7,9,17,20H2,1-3H3/t22-,30+/m0/s1 |
| InChIKey | WSTCQXZUFUQNDQ-SMSORMJASA-N |
| XLogP | 6.09 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.71 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |