C31H31FN4O3S — CID 59094153
cis-(1R,2S)-N-[(8R)-8-[(3-fluorophenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(1-methylimidazol-2-yl)methyl]-2-phenylcyclopropane-1-carboxamide (PubChem CID 59094153) has the molecular formula C31H31FN4O3S and a molecular weight of 558.68 g/mol. Its IUPAC name is cis-(1R,2S)-N-[(8R)-8-[(3-fluorophenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(1-methylimidazol-2-yl)methyl]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[(8R)-8-[(3-fluorophenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(1-methylimidazol-2-yl)methyl]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59094153 |
| Molecular Formula | C31H31FN4O3S |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | cis-(1R,2S)-N-[(8R)-8-[(3-fluorophenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(1-methylimidazol-2-yl)methyl]-2-phenylcyclopropane-1-carboxamide |
| SMILES | Cn1ccnc1CN(C(=O)[C@@H]1C[C@@H]1c1ccccc1)c1ccc2c(c1)[C@H](NS(=O)(=O)c1cccc(F)c1)CCC2 |
| InChI | InChI=1S/C31H31FN4O3S/c1-35-16-15-33-30(35)20-36(31(37)28-19-26(28)21-7-3-2-4-8-21)24-14-13-22-9-5-12-29(27(22)18-24)34-40(38,39)25-11-6-10-23(32)17-25/h2-4,6-8,10-11,13-18,26,28-29,34H,5,9,12,19-20H2,1H3/t26-,28-,29-/m1/s1 |
| InChIKey | AYGVKJLOVUJPKG-CRXYYGHGSA-N |
| XLogP | 5.25 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |