C31H32N4O3S — CID 59094152
cis-(1S,2R)-N-[(8R)-8-(benzenesulfonamido)-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(1-methylimidazol-2-yl)methyl]-2-phenylcyclopropane-1-carboxamide (PubChem CID 59094152) has the molecular formula C31H32N4O3S and a molecular weight of 540.69 g/mol. Its IUPAC name is cis-(1S,2R)-N-[(8R)-8-(benzenesulfonamido)-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(1-methylimidazol-2-yl)methyl]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[(8R)-8-(benzenesulfonamido)-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(1-methylimidazol-2-yl)methyl]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59094152 |
| Molecular Formula | C31H32N4O3S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | cis-(1S,2R)-N-[(8R)-8-(benzenesulfonamido)-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(1-methylimidazol-2-yl)methyl]-2-phenylcyclopropane-1-carboxamide |
| SMILES | Cn1ccnc1CN(C(=O)[C@H]1C[C@H]1c1ccccc1)c1ccc2c(c1)[C@H](NS(=O)(=O)c1ccccc1)CCC2 |
| InChI | InChI=1S/C31H32N4O3S/c1-34-18-17-32-30(34)21-35(31(36)28-20-26(28)22-9-4-2-5-10-22)24-16-15-23-11-8-14-29(27(23)19-24)33-39(37,38)25-12-6-3-7-13-25/h2-7,9-10,12-13,15-19,26,28-29,33H,8,11,14,20-21H2,1H3/t26-,28-,29+/m0/s1 |
| InChIKey | PYMUKKYCOHREKN-PIZZNKLWSA-N |
| XLogP | 5.11 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |