C34H43F3N4OS — CID 142111203
3-(2,4-difluorophenyl)-N-[(1-methylimidazol-2-yl)methyl]-N-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide;ethane;S-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]thiohydroxylamine (PubChem CID 142111203) has the molecular formula C34H43F3N4OS and a molecular weight of 612.81 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-N-[(1-methylimidazol-2-yl)methyl]-N-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide;ethane;S-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]thiohydroxylamine.
| Compound Name | 3-(2,4-difluorophenyl)-N-[(1-methylimidazol-2-yl)methyl]-N-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide;ethane;S-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 142111203 |
| Molecular Formula | C34H43F3N4OS |
| Molecular Weight | 612.81 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | 3-(2,4-difluorophenyl)-N-[(1-methylimidazol-2-yl)methyl]-N-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide;ethane;S-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]thiohydroxylamine |
| SMILES | C=C(F)/C=C\C(=C/C)SN.CC.CC(CC(=O)N(Cc1nccn1C)c1ccc2c(c1)CCCC2)c1ccc(F)cc1F |
| InChI | InChI=1S/C25H27F2N3O.C7H10FNS.C2H6/c1-17(22-10-8-20(26)15-23(22)27)13-25(31)30(16-24-28-11-12-29(24)2)21-9-7-18-5-3-4-6-19(18)14-21;1-3-7(10-9)5-4-6(2)8;1-2/h7-12,14-15,17H,3-6,13,16H2,1-2H3;3-5H,2,9H2,1H3;1-2H3/b;5-4-,7-3+; |
| InChIKey | RRZRWYBIOAVQIM-AHCPHMFRSA-N |
| XLogP | 8.87 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.81 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|