C31H30Cl2N4O2S — CID 142111619
trans-(1S,2S)-2-(2-chlorophenyl)-N-[8-[(3-chlorophenyl)sulfinylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(1-methylimidazol-2-yl)methyl]cyclopropane-1-carboxamide (PubChem CID 142111619) has the molecular formula C31H30Cl2N4O2S and a molecular weight of 593.58 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2-chlorophenyl)-N-[8-[(3-chlorophenyl)sulfinylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(1-methylimidazol-2-yl)methyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-(2-chlorophenyl)-N-[8-[(3-chlorophenyl)sulfinylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(1-methylimidazol-2-yl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 142111619 |
| Molecular Formula | C31H30Cl2N4O2S |
| Molecular Weight | 593.58 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | trans-(1S,2S)-2-(2-chlorophenyl)-N-[8-[(3-chlorophenyl)sulfinylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(1-methylimidazol-2-yl)methyl]cyclopropane-1-carboxamide |
| SMILES | Cn1ccnc1CN(C(=O)[C@H]1C[C@@H]1c1ccccc1Cl)c1ccc2c(c1)C(NS(=O)c1cccc(Cl)c1)CCC2 |
| InChI | InChI=1S/C31H30Cl2N4O2S/c1-36-15-14-34-30(36)19-37(31(38)27-18-26(27)24-9-2-3-10-28(24)33)22-13-12-20-6-4-11-29(25(20)17-22)35-40(39)23-8-5-7-21(32)16-23/h2-3,5,7-10,12-17,26-27,29,35H,4,6,11,18-19H2,1H3/t26-,27+,29?,40?/m1/s1 |
| InChIKey | GYUIKCXUAMUJBD-XUOMNAGJSA-N |
| XLogP | 6.75 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.58 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |