C23H28ClN7O2 — CID 142112036
5-chloro-2-[[(2Z,4E)-2,5-diamino-5-(1,4-diazepan-1-yl)penta-2,4-dienoyl]amino]-N-(5-methyl-2-pyridinyl)benzamide (PubChem CID 142112036) has the molecular formula C23H28ClN7O2 and a molecular weight of 469.98 g/mol. Its IUPAC name is 5-chloro-2-[[(2Z,4E)-2,5-diamino-5-(1,4-diazepan-1-yl)penta-2,4-dienoyl]amino]-N-(5-methyl-2-pyridinyl)benzamide.
| Compound Name | 5-chloro-2-[[(2Z,4E)-2,5-diamino-5-(1,4-diazepan-1-yl)penta-2,4-dienoyl]amino]-N-(5-methyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 142112036 |
| Molecular Formula | C23H28ClN7O2 |
| Molecular Weight | 469.98 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 5-chloro-2-[[(2Z,4E)-2,5-diamino-5-(1,4-diazepan-1-yl)penta-2,4-dienoyl]amino]-N-(5-methyl-2-pyridinyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(Cl)ccc2NC(=O)/C(N)=C/C=C(\N)N2CCCNCC2)nc1 |
| InChI | InChI=1S/C23H28ClN7O2/c1-15-3-8-21(28-14-15)30-22(32)17-13-16(24)4-6-19(17)29-23(33)18(25)5-7-20(26)31-11-2-9-27-10-12-31/h3-8,13-14,27H,2,9-12,25-26H2,1H3,(H,29,33)(H,28,30,32)/b18-5-,20-7+ |
| InChIKey | FOLAOBLKLMYXNY-XHLKNFSQSA-N |
| XLogP | 2.17 |
| TPSA | 138.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.98 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|