C28H36ClN7O4 — CID 142112034
tert-butyl 4-[(1E,3Z)-1,4-diamino-5-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methylanilino]-5-oxopenta-1,3-dienyl]-1,4-diazepane-1-carboxylate (PubChem CID 142112034) has the molecular formula C28H36ClN7O4 and a molecular weight of 570.09 g/mol. Its IUPAC name is tert-butyl 4-[(1E,3Z)-1,4-diamino-5-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methylanilino]-5-oxopenta-1,3-dienyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[(1E,3Z)-1,4-diamino-5-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methylanilino]-5-oxopenta-1,3-dienyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 142112034 |
| Molecular Formula | C28H36ClN7O4 |
| Molecular Weight | 570.09 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | tert-butyl 4-[(1E,3Z)-1,4-diamino-5-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methylanilino]-5-oxopenta-1,3-dienyl]-1,4-diazepane-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)/C(N)=C/C=C(\N)N2CCCN(C(=O)OC(C)(C)C)CC2)c(C(=O)Nc2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C28H36ClN7O4/c1-18-6-9-22(20(16-18)25(37)34-24-11-7-19(29)17-32-24)33-26(38)21(30)8-10-23(31)35-12-5-13-36(15-14-35)27(39)40-28(2,3)4/h6-11,16-17H,5,12-15,30-31H2,1-4H3,(H,33,38)(H,32,34,37)/b21-8-,23-10+ |
| InChIKey | NYLMWPHZTLZNGV-YWSAOPMPSA-N |
| XLogP | 3.82 |
| TPSA | 155.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.09 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|