C13H12F2N3O2+ — CID 142112043
[4,5-difluoro-2-[(5-methyl-2-pyridinyl)carbamoyl]phenyl]-hydroxyazanium (PubChem CID 142112043) has the molecular formula C13H12F2N3O2+ and a molecular weight of 280.25 g/mol. Its IUPAC name is [4,5-difluoro-2-[(5-methyl-2-pyridinyl)carbamoyl]phenyl]-hydroxyazanium.
| Compound Name | [4,5-difluoro-2-[(5-methyl-2-pyridinyl)carbamoyl]phenyl]-hydroxyazanium |
|---|---|
| PubChem CID | 142112043 |
| Molecular Formula | C13H12F2N3O2+ |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | [4,5-difluoro-2-[(5-methyl-2-pyridinyl)carbamoyl]phenyl]-hydroxyazanium |
| SMILES | Cc1ccc(NC(=O)c2cc(F)c(F)cc2[NH2+]O)nc1 |
| InChI | InChI=1S/C13H11F2N3O2/c1-7-2-3-12(16-6-7)17-13(19)8-4-9(14)10(15)5-11(8)18-20/h2-6,18,20H,1H3,(H,16,17,19)/p+1 |
| InChIKey | JRASWSNBVYQNGD-UHFFFAOYSA-O |
| XLogP | 1.50 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|