About ethane;1-methoxy-2-methyl-4-propylbenzene;prop-1-yne
ethane;1-methoxy-2-methyl-4-propylbenzene;prop-1-yne (PubChem CID 142112207) has the molecular formula C16H26O
and a molecular weight of 234.38 g/mol. Its IUPAC name is ethane;1-methoxy-2-methyl-4-propylbenzene;prop-1-yne.
Molecular Properties
| Compound Name | ethane;1-methoxy-2-methyl-4-propylbenzene;prop-1-yne |
| PubChem CID | 142112207 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | ethane;1-methoxy-2-methyl-4-propylbenzene;prop-1-yne |
| SMILES | C#CC.CC.CCCc1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C11H16O.C3H4.C2H6/c1-4-5-10-6-7-11(12-3)9(2)8-10;1-3-2;1-2/h6-8H,4-5H2,1-3H3;1H,2H3;1-2H3 |
| InChIKey | SFVIJSFSNVYHEE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methoxy-2-methyl-4-propylbenzene;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methoxy-2-methyl-4-propylbenzene;prop-1-yne?
The IUPAC name of ethane;1-methoxy-2-methyl-4-propylbenzene;prop-1-yne (CID 142112207) is ethane;1-methoxy-2-methyl-4-propylbenzene;prop-1-yne.
What is the SMILES notation for ethane;1-methoxy-2-methyl-4-propylbenzene;prop-1-yne?
The canonical SMILES for ethane;1-methoxy-2-methyl-4-propylbenzene;prop-1-yne is C#CC.CC.CCCc1ccc(OC)c(C)c1.
What is the InChIKey of ethane;1-methoxy-2-methyl-4-propylbenzene;prop-1-yne?
The InChIKey is SFVIJSFSNVYHEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.C3H4.C2H6/c1-4-5-10-6-7-11(12-3)9(2)8-10;1-3-2;1-2/h6-8H,4-5H2,1-3H3;1H,2H3;1-2H3.
What are the key properties of ethane;1-methoxy-2-methyl-4-propylbenzene;prop-1-yne?
ethane;1-methoxy-2-methyl-4-propylbenzene;prop-1-yne has a molecular weight of 234.38 g/mol, XLogP of 4.62, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methoxy-2-methyl-4-propylbenzene;prop-1-yne is sourced from PubChem (CID 142112207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).