C20H16FN3O2 — CID 142112737
N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-2-hydroxybenzamide (PubChem CID 142112737) has the molecular formula C20H16FN3O2 and a molecular weight of 349.37 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-2-hydroxybenzamide.
| Compound Name | N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 142112737 |
| Molecular Formula | C20H16FN3O2 |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-2-hydroxybenzamide |
| SMILES | O=C(Nc1ccc2c(c1)C(c1ccc(F)cc1)NN2)c1ccccc1O |
| InChI | InChI=1S/C20H16FN3O2/c21-13-7-5-12(6-8-13)19-16-11-14(9-10-17(16)23-24-19)22-20(26)15-3-1-2-4-18(15)25/h1-11,19,23-25H,(H,22,26) |
| InChIKey | VOMMIGNIUXVJOM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |