About N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-4-phenylbenzamide
N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-4-phenylbenzamide (PubChem CID 67564592) has the molecular formula C26H20FN3O
and a molecular weight of 409.46 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-4-phenylbenzamide.
Molecular Properties
| Compound Name | N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-4-phenylbenzamide |
| PubChem CID | 67564592 |
| Molecular Formula | C26H20FN3O |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-4-phenylbenzamide |
| SMILES | O=C(Nc1ccc2c(c1)C(c1ccc(F)cc1)NN2)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H20FN3O/c27-21-12-10-19(11-13-21)25-23-16-22(14-15-24(23)29-30-25)28-26(31)20-8-6-18(7-9-20)17-4-2-1-3-5-17/h1-16,25,29-30H,(H,28,31) |
| InChIKey | SCDZOCVVQGIHJZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-4-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-4-phenylbenzamide?
The IUPAC name of N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-4-phenylbenzamide (CID 67564592) is N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-4-phenylbenzamide.
What is the SMILES notation for N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-4-phenylbenzamide?
The canonical SMILES for N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-4-phenylbenzamide is O=C(Nc1ccc2c(c1)C(c1ccc(F)cc1)NN2)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-4-phenylbenzamide?
The InChIKey is SCDZOCVVQGIHJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20FN3O/c27-21-12-10-19(11-13-21)25-23-16-22(14-15-24(23)29-30-25)28-26(31)20-8-6-18(7-9-20)17-4-2-1-3-5-17/h1-16,25,29-30H,(H,28,31).
What are the key properties of N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-4-phenylbenzamide?
N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-4-phenylbenzamide has a molecular weight of 409.46 g/mol, XLogP of 5.76, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(4-fluorophenyl)-2,3-dihydro-1H-indazol-5-yl]-4-phenylbenzamide is sourced from PubChem (CID 67564592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).