C16H18FN3O2 — CID 142112752
3-(4-fluorophenyl)-2,5-dimethyl-1,3-dihydroindazole;N-hydroxyformamide (PubChem CID 142112752) has the molecular formula C16H18FN3O2 and a molecular weight of 303.34 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2,5-dimethyl-1,3-dihydroindazole;N-hydroxyformamide.
| Compound Name | 3-(4-fluorophenyl)-2,5-dimethyl-1,3-dihydroindazole;N-hydroxyformamide |
|---|---|
| PubChem CID | 142112752 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 3-(4-fluorophenyl)-2,5-dimethyl-1,3-dihydroindazole;N-hydroxyformamide |
| SMILES | Cc1ccc2c(c1)C(c1ccc(F)cc1)N(C)N2.O=CNO |
| InChI | InChI=1S/C15H15FN2.CH3NO2/c1-10-3-8-14-13(9-10)15(18(2)17-14)11-4-6-12(16)7-5-11;3-1-2-4/h3-9,15,17H,1-2H3;1,4H,(H,2,3) |
| InChIKey | BNWVFXPTTGYORJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|