C12H23N — CID 142113031
N,N-diethyl-6-methylhepta-1,5-dien-3-amine (PubChem CID 142113031) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N,N-diethyl-6-methylhepta-1,5-dien-3-amine.
| Compound Name | N,N-diethyl-6-methylhepta-1,5-dien-3-amine |
|---|---|
| PubChem CID | 142113031 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N,N-diethyl-6-methylhepta-1,5-dien-3-amine |
| SMILES | C=CC(CC=C(C)C)N(CC)CC |
| InChI | InChI=1S/C12H23N/c1-6-12(10-9-11(4)5)13(7-2)8-3/h6,9,12H,1,7-8,10H2,2-5H3 |
| InChIKey | VTIJKZFTRJWQSC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|