C11H24N2 — CID 102472696
1-N,1-N,1-N',1-N'-tetraethylprop-2-ene-1,1-diamine (PubChem CID 102472696) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N'-tetraethylprop-2-ene-1,1-diamine.
| Compound Name | 1-N,1-N,1-N',1-N'-tetraethylprop-2-ene-1,1-diamine |
|---|---|
| PubChem CID | 102472696 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1-N,1-N,1-N',1-N'-tetraethylprop-2-ene-1,1-diamine |
| SMILES | C=CC(N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C11H24N2/c1-6-11(12(7-2)8-3)13(9-4)10-5/h6,11H,1,7-10H2,2-5H3 |
| InChIKey | IGICYVXBEVWUAM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|