C11H24N2 — CID 167204668
N-but-3-en-2-yl-N-ethyl-N',2-dimethylpropane-1,3-diamine (PubChem CID 167204668) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is N-but-3-en-2-yl-N-ethyl-N',2-dimethylpropane-1,3-diamine.
| Compound Name | N-but-3-en-2-yl-N-ethyl-N',2-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 167204668 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N-but-3-en-2-yl-N-ethyl-N',2-dimethylpropane-1,3-diamine |
| SMILES | C=CC(C)N(CC)CC(C)CNC |
| InChI | InChI=1S/C11H24N2/c1-6-11(4)13(7-2)9-10(3)8-12-5/h6,10-12H,1,7-9H2,2-5H3 |
| InChIKey | VMQUJKLQNPOJBW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|